EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23N3O4 |
| Net Charge | 0 |
| Average Mass | 273.333 |
| Monoisotopic Mass | 273.16886 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C12H23N3O4/c1-6(2)5-9(15-10(16)7(3)13)11(17)14-8(4)12(18)19/h6-9H,5,13H2,1-4H3,(H,14,17)(H,15,16)(H,18,19)/t7-,8-,9-/m0/s1 |
| InChIKey | HCZXHQADHZIEJD-CIUDSAMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Leu-Ala (CHEBI:158283) has functional parent L-alanine (CHEBI:16977) |
| Ala-Leu-Ala (CHEBI:158283) has functional parent L-leucine (CHEBI:15603) |
| Ala-Leu-Ala (CHEBI:158283) is a tripeptide (CHEBI:47923) |
| Ala-Leu-Ala (CHEBI:158283) is tautomer of Ala-Leu-Ala zwitterion (CHEBI:191212) |
| Incoming Relation(s) |
| Ala-Leu-Ala zwitterion (CHEBI:191212) is tautomer of Ala-Leu-Ala (CHEBI:158283) |
| IUPAC Name |
|---|
| L-alanyl-L-leucyl-L-alanine |
| Synonyms | Source |
|---|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoyl]amino]propanoic acid | SUBMITTER |
| L-Ala-L-Leu-L-Ala | ChEBI |
| ALA | ChEBI |
| A-L-A | ChEBI |
| alanylleucyl alanine | ChEBI |
| H-L-Ala-L-Leu-L-Ala-OH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5379140 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:54865-21-3 | ChEBI |
| Citations |
|---|