EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H35N9O15P2 |
| Net Charge | 0 |
| Average Mass | 715.507 |
| Monoisotopic Mass | 715.17278 |
| SMILES | N=C(NCCC[C@H](N)C(=O)O)N[C@H]1O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H35N9O15P2/c22-8(20(35)36)2-1-3-25-21(24)29-18-14(33)12(31)9(43-18)4-41-46(37,38)45-47(39,40)42-5-10-13(32)15(34)19(44-10)30-7-28-11-16(23)26-6-27-17(11)30/h6-10,12-15,18-19,31-34H,1-5,22H2,(H,35,36)(H,37,38)(H,39,40)(H2,23,26,27)(H3,24,25,29)/t8-,9+,10+,12+,13+,14+,15+,18-,19+/m0/s1 |
| InChIKey | IWVSYNGKNZFSSA-PTDVUUCPSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nω-(ADP-D-ribosyl)-L-arginine (CHEBI:15827) has functional parent ADP-D-ribose (CHEBI:16960) |
| Nω-(ADP-D-ribosyl)-L-arginine (CHEBI:15827) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| Nω-(ADP-D-ribosyl)-L-arginine (CHEBI:15827) is a L-arginine derivative (CHEBI:83965) |
| Nω-(ADP-D-ribosyl)-L-arginine (CHEBI:15827) is conjugate acid of Nω-(ADP-D-ribosyl)-L-arginine(1−) (CHEBI:60267) |
| Incoming Relation(s) |
| Nω-(ADP-D-ribosyl)-L-arginine(1−) (CHEBI:60267) is conjugate base of Nω-(ADP-D-ribosyl)-L-arginine (CHEBI:15827) |
| IUPAC Name |
|---|
| adenosine 5'-{3-[1-(Nω-arginino)-1-deoxy-α-D-ribofuranos-5-yl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| N(omega)-(ADP-D-ribosyl)-L-arginine | KEGG COMPOUND |
| Nomega-(ADP-D-ribosyl)-L-arginine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01201 | KEGG COMPOUND |