EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6O3 |
| Net Charge | 0 |
| Average Mass | 174.155 |
| Monoisotopic Mass | 174.03169 |
| SMILES | O=C1C=CC(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C10H6O3/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h1-5,12H |
| InChIKey | KQPYUDDGWXQXHS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Juglans nigra (ncbitaxon:16719) | leaf (BTO:0000713) | PubMed (28166217) |
| Roles Classification |
|---|
| Chemical Role: | reactive oxygen species generator Any entity used to generate reactive oxygen species. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| juglone (CHEBI:15794) has role geroprotector (CHEBI:176497) |
| juglone (CHEBI:15794) has role herbicide (CHEBI:24527) |
| juglone (CHEBI:15794) has role reactive oxygen species generator (CHEBI:70982) |
| juglone (CHEBI:15794) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| IUPAC Name |
|---|
| 5-hydroxy-1,4-naphthoquinone |
| Synonyms | Source |
|---|---|
| 5-hydroxy-1,4-naphthalenedione | ChemIDplus |
| 5-Hydroxy-1,4-naphthoquinone | KEGG COMPOUND |
| 8-hydroxy-1,4-naphthoquinone | ChemIDplus |
| Juglone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| juglone | UniProt |
| Citations |
|---|