EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1c(-c2ccc(O)cc2)oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C16H12O6/c1-21-16-14(20)13-11(19)6-10(18)7-12(13)22-15(16)8-2-4-9(17)5-3-8/h2-7,17-19H,1H3 |
| InChIKey | VJJZJBUCDWKPLC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caragana leucophloea (ncbitaxon:390497) | aerial part (BTO:0001658) | PubMed (25675255) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methoxyapigenin (CHEBI:1579) has functional parent apigenin (CHEBI:18388) |
| 3-methoxyapigenin (CHEBI:1579) has role plant metabolite (CHEBI:76924) |
| 3-methoxyapigenin (CHEBI:1579) is a monomethoxyflavone (CHEBI:25401) |
| 3-methoxyapigenin (CHEBI:1579) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-methoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 3-O-Methylkaempferol | KEGG COMPOUND |
| 5,7,4'-trihydroxy-3-methoxyflavone | LIPID MAPS |
| Isokaempferide | LIPID MAPS |
| kaempferol-3-O-methyl ether | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00001062 | KNApSAcK |
| C05902 | KEGG COMPOUND |
| LMPK12112688 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:305374 | Reaxys |
| CAS:1592-70-7 | ChemIDplus |
| Citations |
|---|