EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10NO5S.Na |
| Net Charge | 0 |
| Average Mass | 255.227 |
| Monoisotopic Mass | 255.01774 |
| SMILES | [H][C@@]12CC(=O)N1[C@@H](C(=O)[O-])C(C)(C)S2(=O)=O.[Na+] |
| InChI | InChI=1S/C8H11NO5S.Na/c1-8(2)6(7(11)12)9-4(10)3-5(9)15(8,13)14;/h5-6H,3H2,1-2H3,(H,11,12);/q;+1/p-1/t5-,6+;/m1./s1 |
| InChIKey | NKZMPZCWBSWAOX-IBTYICNHSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulbactam sodium (CHEBI:157785) has part sulbactam(1−) (CHEBI:229543) |
| sulbactam sodium (CHEBI:157785) is a organic sodium salt (CHEBI:38700) |
| sulbactam sodium (CHEBI:157785) is a β-lactam antibiotic (CHEBI:27933) |
| Incoming Relation(s) |
| xacduro (CHEBI:229547) has part sulbactam sodium (CHEBI:157785) |
| IUPAC Name |
|---|
| sodium (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide |
| Synonyms | Source |
|---|---|
| sodium sulbactam | ChEBI |
| CP 45899-2 | ChEBI |
| penicillanic acid 1,1-dioxide sodium salt | ChEBI |
| sodium 1,1-dioxypenicillanate | ChEBI |
| sulbactam sodium salt | ChEBI |
| sodium penicillanate 1,1-dioxide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14001 | KEGG COMPOUND |
| D02223 | KEGG DRUG |
| 571120 | ChemSpider |
| DBSALT001310 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:69388-84-7 | KEGG COMPOUND |
| Citations |
|---|