EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO2 |
| Net Charge | 0 |
| Average Mass | 157.213 |
| Monoisotopic Mass | 157.11028 |
| SMILES | C[N+]1(C)CCCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C8H15NO2/c1-9(2)6-4-3-5-7(9)8(10)11/h7H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | XULZWQRXYTVUTE-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-Homostachydrine (CHEBI:157781) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-1,1-dimethylpiperidin-1-ium-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 390180 | ChemSpider |
| C08283 | KEGG COMPOUND |
| HMDB0033433 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:472-22-0 | ChemIDplus |