EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CC/C=C\C[C@H](O)/C=C\C=C/C=C/C=C/[C@H](O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-3-8-12-17(21)13-9-6-4-5-7-10-14-18(22)19(23)15-11-16-20(24)25/h3-10,13-14,17-19,21-23H,2,11-12,15-16H2,1H3,(H,24,25)/b6-4-,7-5+,8-3-,13-9-,14-10+/t17-,18-,19-/m0/s1 |
| InChIKey | ZZMKOZNTEJVKRY-MCPYMSAWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | microglia (BTO:0000078) | MetaboLights (MTBLS1952) | Strain: ICR Mouse [NCIT:C37408] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lipoxin A5 (CHEBI:157748) is a HEPE (CHEBI:72799) |
| IUPAC Name |
|---|
| (5S,6S,7E,9E,11Z,13Z,15S,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4944295 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:95851-20-0 | ChemIDplus |