EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NO2 |
| Net Charge | 0 |
| Average Mass | 231.295 |
| Monoisotopic Mass | 231.12593 |
| SMILES | COc1cccc(/C=C/C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C14H17NO2/c1-17-13-6-4-5-12(11-13)7-8-14(16)15-9-2-3-10-15/h4-8,11H,2-3,9-10H2,1H3/b8-7+ |
| InChIKey | LAPTWLCIZWFMJK-BQYQJAHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper methysticum (ncbitaxon:130404) | |||
| lateral root (BTO:0005441) | MetaboLights (MTBLS1485) | Strain: Piper methysticum cv. Loa Kasa Leka | |
| crown root (PO:0000043) | MetaboLights (MTBLS1485) | Strain: Piper methysticum cv. Loa Kasa Leka | |
| stem (BTO:0001300) | MetaboLights (MTBLS1485) | Strain: Piper methysticum cv. Loa Kasa Leka |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyrrolidine, 1-(m-methoxycinnamoyl)- (CHEBI:157735) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(3-methoxyphenyl)-1-pyrrolidin-1-ylprop-2-en-1-one |
| Manual Xrefs | Databases |
|---|---|
| 4523676 | ChemSpider |
| HMDB0038839 | HMDB |