EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O4 |
| Net Charge | 0 |
| Average Mass | 316.397 |
| Monoisotopic Mass | 316.16746 |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)/C=C/c1ccc(O)c(O)c1)C2 |
| InChI | InChI=1S/C19H24O4/c1-18(2)13-8-9-19(18,3)16(11-13)23-17(22)7-5-12-4-6-14(20)15(21)10-12/h4-7,10,13,16,20-21H,8-9,11H2,1-3H3/b7-5+ |
| InChIKey | NOYGOWYVUFENNY-FNORWQNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper methysticum (ncbitaxon:130404) | |||
| lateral root (BTO:0005441) | MetaboLights (MTBLS1485) | Strain: Piper methysticum cv. Loa Kasa Leka | |
| crown root (PO:0000043) | MetaboLights (MTBLS1485) | Strain: Piper methysticum cv. Loa Kasa Leka | |
| stem (BTO:0001300) | MetaboLights (MTBLS1485) | Strain: Piper methysticum cv. Loa Kasa Leka |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-bornyl-caffeate (CHEBI:157708) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 4585218 | ChemSpider |