EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:157683 - althiomycin
| Formula | C16H17N5O6S2 |
| Net Charge | 0 |
| Average Mass | 439.475 |
| Monoisotopic Mass | 439.06203 |
| SMILES | COC1=CC(=O)N(C(=O)[C@H]2CSC(C(CO)NC(=O)c3csc(/C=N/O)n3)=N2)C1 |
| InChI | InChI=1S/C16H17N5O6S2/c1-27-8-2-13(23)21(4-8)16(25)11-7-29-15(20-11)9(5-22)19-14(24)10-6-28-12(18-10)3-17-26/h2-3,6,9,11,22,26H,4-5,7H2,1H3,(H,19,24)/b17-3+/t9?,11-/m1/s1 |
| InChIKey | VQQNQKXWJMRPHT-GMLCBOFYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces matensis (ncbitaxon:67325) | - | DOI (10.1007/978-3-642-46304-4_21) | |
| Cystobacter fuscus (ncbitaxon:43) | - | PubMed (6809724) | Strain: Cb 685 |
| Myxococcus virescens (ncbitaxon:83456) | |||
| - | PubMed (6809724) | Strain: Mx v12 | |
| - | PubMed (6809724) | Strain: Mx v54 | |
| Myxococcus xanthus (ncbitaxon:34) | |||
| - | PubMed (6809724) | Strain: Mx x52 | |
| - | PubMed (21626639) | Strain: DK897 | |
| Streptomyces althioticus (ncbitaxon:83380) | - | PubMed (6809724) | |
| Serratia marcescens subsp. marcescens Db11 (ncbitaxon:273526) | - | PubMed (23028578) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| althiomycin (CHEBI:157683) has role antibacterial agent (CHEBI:33282) |
| althiomycin (CHEBI:157683) has role bacterial metabolite (CHEBI:76969) |
| althiomycin (CHEBI:157683) has role protein synthesis inhibitor (CHEBI:48001) |
| althiomycin (CHEBI:157683) is a 1,3-thiazoles (CHEBI:38418) |
| althiomycin (CHEBI:157683) is a aldoxime (CHEBI:22307) |
| althiomycin (CHEBI:157683) is a ether (CHEBI:25698) |
| althiomycin (CHEBI:157683) is a peptide antibiotic (CHEBI:25903) |
| althiomycin (CHEBI:157683) is a primary alcohol (CHEBI:15734) |
| althiomycin (CHEBI:157683) is a pyrroline (CHEBI:23763) |
| althiomycin (CHEBI:157683) is a secondary carboxamide (CHEBI:140325) |
| althiomycin (CHEBI:157683) is a tertiary carboxamide (CHEBI:140326) |
| althiomycin (CHEBI:157683) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| 2-[(E)-(hydroxyimino)methyl]-N-(2-hydroxy-1-{(4S)-4-[(4-methoxy-2-oxo-2,5-dihydro-1H-pyrrol-1-yl)carbonyl]-4,5-dihydro-1,3-thiazol-2-yl}ethyl)-1,3-thiazole-4-carboxamide |
| Synonyms | Source |
|---|---|
| matamycin | ChemIDplus |
| altiomycin | ChemIDplus |
| N-{2-hydroxy-1-[(4S)-4-(4-methoxy-2-oxo-2,5-dihydro-1H-pyrrole-1-carbonyl)-4,5-dihydro-1,3-thiazol-2-yl]ethyl}-2-[(E)-(hydroxyimino)methyl]-1,3-thiazole-4-carboxamide | IUPAC |
| 116-A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Althiomycin | Wikipedia |
| C00018669 | KNApSAcK |
| 4576669 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:12656-40-5 | ChemIDplus |
| Citations |
|---|