EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O3 |
| Net Charge | 0 |
| Average Mass | 220.268 |
| Monoisotopic Mass | 220.10994 |
| SMILES | O=C(O)[C@H]1CCCC[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C13H16O3/c14-12(15)11-8-4-5-9-13(11,16)10-6-2-1-3-7-10/h1-3,6-7,11,16H,4-5,8-9H2,(H,14,15)/t11-,13+/m1/s1 |
| InChIKey | VCZPUGSOJXZKIP-YPMHNXCESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R)-cicloxilic acid (CHEBI:157630) is a 2-hydroxy-2-phenylcyclohexanecarboxylic acid (CHEBI:157631) |
| (1S,2R)-cicloxilic acid (CHEBI:157630) is enantiomer of (1R,2S)-cicloxilic acid (CHEBI:157629) |
| Incoming Relation(s) |
| cicloxilic acid (CHEBI:134906) has part (1S,2R)-cicloxilic acid (CHEBI:157630) |
| (1R,2S)-cicloxilic acid (CHEBI:157629) is enantiomer of (1S,2R)-cicloxilic acid (CHEBI:157630) |
| IUPAC Name |
|---|
| (1S,2R)-2-hydroxy-2-phenylcyclohexanecarboxylic acid |
| Synonyms | Source |
|---|---|
| (1S,2R)-2-hydroxy-2-phenylcyclohexane-1-carboxylic acid | IUPAC |
| 2α-hydroxy-2-phenylcyclohexane-1α-carboxylic acid | ChEBI |