EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:157611 - evolidine
| Formula | C38H58N8O9 |
| Net Charge | 0 |
| Average Mass | 770.929 |
| Monoisotopic Mass | 770.43268 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CC(C)C)NC(=O)C(Cc2ccccc2)NC(=O)[C@H](CO)NC1=O |
| InChI | InChI=1S/C38H58N8O9/c1-20(2)15-24-32(49)44-28(19-47)35(52)41-25(17-23-11-8-7-9-12-23)33(50)43-27(16-21(3)4)38(55)46-14-10-13-29(46)36(53)45-31(22(5)6)37(54)42-26(18-30(39)48)34(51)40-24/h7-9,11-12,20-22,24-29,31,47H,10,13-19H2,1-6H3,(H2,39,48)(H,40,51)(H,41,52)(H,42,54)(H,43,50)(H,44,49)(H,45,53)/t24-,25?,26-,27-,28-,29-,31-/m0/s1 |
| InChIKey | ZMEFLPQESSYXEE-JZBUTRSJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melicope xanthoxyloides (ncbitaxon:1312821) | leaf (BTO:0000713) | PubMed (32817170) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| evolidine (CHEBI:157611) has role plant metabolite (CHEBI:76924) |
| evolidine (CHEBI:157611) is a orbitide (CHEBI:157605) |
| Synonyms | Source |
|---|---|
| cyclo-(Ser-Phe-Leu-Pro-Val-Asn-Leu) | SUBMITTER |
| cyclo-SFLPVNL | SUBMITTER |
| Citations |
|---|