EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | [H][C@@]12C=C(C)CC[C@]1(C)[C@@]1(C)C[C@@H](O)[C@@]([H])(O2)[C@@]12CO2 |
| InChI | InChI=1S/C15H22O3/c1-9-4-5-13(2)11(6-9)18-12-10(16)7-14(13,3)15(12)8-17-15/h6,10-12,16H,4-5,7-8H2,1-3H3/t10-,11-,12-,13+,14-,15+/m1/s1 |
| InChIKey | ICJDGHMOMSQSLB-LACSLYJWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium graminearum (ncbitaxon:5518) | - | PubMed (8684431) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isotrichodermol (CHEBI:157603) has role fungal metabolite (CHEBI:76946) |
| isotrichodermol (CHEBI:157603) is a organic heterotetracyclic compound (CHEBI:38163) |
| isotrichodermol (CHEBI:157603) is a secondary alcohol (CHEBI:35681) |
| isotrichodermol (CHEBI:157603) is a trichothecene (CHEBI:55517) |
| IUPAC Name |
|---|
| 12,13-epoxytrichothec-9-en-3α-ol |
| Synonyms | Source |
|---|---|
| 3-hydroxytrichothecene | KNApSAcK |
| (3α)-12,13-epoxytrichothec-9-en-3-ol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| isotrichodermol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00012644 | KNApSAcK |
| CPD-18408 | MetaCyc |
| FDB014496 | FooDB |
| HMDB0035760 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:104155-10-4 | ChemIDplus |
| Citations |
|---|