EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25N5O15P2 |
| Net Charge | 0 |
| Average Mass | 589.344 |
| Monoisotopic Mass | 589.08224 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H25N5O15P2/c17-13-7-14(19-3-18-13)21(4-20-7)15-11(26)9(24)6(33-15)2-32-37(28,29)36-38(30,31)35-16-12(27)10(25)8(23)5(1-22)34-16/h3-6,8-12,15-16,22-27H,1-2H2,(H,28,29)(H,30,31)(H2,17,18,19)/t5-,6-,8-,9-,10+,11-,12-,15-,16-/m1/s1 |
| InChIKey | WFPZSXYXPSUOPY-ROYWQJLOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (23537328) | ||
| - | PubMed (21988831) | ||
| Zea mays (ncbitaxon:4577) | seed (BTO:0001226) | PubMed (23292602) | seed endosperm |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ADP α-D-glucoside (CHEBI:15751) has role Escherichia coli metabolite (CHEBI:76971) |
| ADP α-D-glucoside (CHEBI:15751) has role plant metabolite (CHEBI:76924) |
| ADP α-D-glucoside (CHEBI:15751) is a ADP-aldose (CHEBI:17193) |
| ADP α-D-glucoside (CHEBI:15751) is a α-D-glucoside (CHEBI:22390) |
| ADP α-D-glucoside (CHEBI:15751) is conjugate acid of ADP α-D-glucoside(2−) (CHEBI:57498) |
| Incoming Relation(s) |
| ADP α-D-glucoside(2−) (CHEBI:57498) is conjugate base of ADP α-D-glucoside (CHEBI:15751) |
| IUPAC Name |
|---|
| adenosine 5'-[3-(α-D-glucopyranosyl) dihydrogen diphosphate] |
| Synonyms | Source |
|---|---|
| Adenosine diphosphate glucose | ChemIDplus |
| Adenosine diphosphoglucose | KEGG COMPOUND |
| Adenosine pyrophosphateglucose | ChemIDplus |
| ADPG | ChemIDplus |
| ADP-glucose | KEGG COMPOUND |
| ADPglucose | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| ADQ | PDBeChem |
| C00498 | KEGG COMPOUND |
| ECMDB06557 | ECMDB |
| G11109 | KEGG GLYCAN |
| HMDB0006557 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1207857 | Reaxys |
| CAS:2140-58-1 | ChemIDplus |
| Citations |
|---|