EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17FN4O3 |
| Net Charge | 0 |
| Average Mass | 320.324 |
| Monoisotopic Mass | 320.12847 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)nc21 |
| InChI | InChI=1S/C15H17FN4O3/c1-2-19-8-10(15(22)23)12(21)9-7-11(16)14(18-13(9)19)20-5-3-17-4-6-20/h7-8,17H,2-6H2,1H3,(H,22,23) |
| InChIKey | IDYZIJYBMGIQMJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enoxacin (CHEBI:157175) has role antibacterial drug (CHEBI:36047) |
| enoxacin (CHEBI:157175) has role DNA synthesis inhibitor (CHEBI:59517) |
| enoxacin (CHEBI:157175) is a N-arylpiperazine (CHEBI:46848) |
| enoxacin (CHEBI:157175) is a 1,8-naphthyridine derivative (CHEBI:73537) |
| enoxacin (CHEBI:157175) is a amino acid (CHEBI:33709) |
| enoxacin (CHEBI:157175) is a fluoroquinolone antibiotic (CHEBI:87211) |
| enoxacin (CHEBI:157175) is a monocarboxylic acid (CHEBI:25384) |
| enoxacin (CHEBI:157175) is a quinolone antibiotic (CHEBI:86324) |
| IUPAC Name |
|---|
| 1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
| INNs | Source |
|---|---|
| enoxacin | ChemIDplus |
| enoxacine | ChemIDplus |
| enoxacino | ChemIDplus |
| enoxacinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-1,8-naphthyridine-3-carboxylic acid | ChemIDplus |
| 1-Ethyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,4-dihydro-[1,8]naphthyridine-3-carboxylic acid | ChEMBL |
| Enoxacin | KEGG COMPOUND |
| ENOXACIN | ChEMBL |
| Citations |
|---|