EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H40N7O15P |
| Net Charge | 0 |
| Average Mass | 661.559 |
| Monoisotopic Mass | 661.23200 |
| SMILES | [H]C(=O)[C@@]1(O)[C@H](C)O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O)[C@@H]2NC(=N)N)[C@@H]1O[C@@H]1O[C@@H](CO)[C@H](O)[C@@H](OP(=O)(O)O)[C@@H]1NC |
| InChI | InChI=1S/C21H40N7O15P/c1-5-21(35,4-30)16(42-17-9(26-2)15(43-44(36,37)38)10(31)6(3-29)40-17)18(39-5)41-14-8(28-20(24)25)11(32)7(27-19(22)23)12(33)13(14)34/h4-18,26,29,31-35H,3H2,1-2H3,(H4,22,23,27)(H4,24,25,28)(H2,36,37,38)/t5-,6-,7+,8-,9-,10-,11+,12-,13+,14+,15-,16-,17-,18-,21+/m0/s1 |
| InChIKey | BFUAJTIVTIKBSB-GOUKQLAUSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptomycin 3''-phosphate (CHEBI:15715) is a streptomycin phosphate (CHEBI:26787) |
| streptomycin 3''-phosphate (CHEBI:15715) is conjugate base of streptomycin 3''-phosphate(1+) (CHEBI:57482) |
| Incoming Relation(s) |
| streptomycin 3''-phosphate(1+) (CHEBI:57482) is conjugate acid of streptomycin 3''-phosphate (CHEBI:15715) |
| IUPAC Name |
|---|
| [2-deoxy-2-(methylamino)-3-O-phosphono-α-L-glucopyranosyl]-(1→2)-[5-deoxy-3-C-formyl-α-L-lyxofuranosyl]-(1→4)-{N',N'''-[(1,3,5/2,4,6)-2,4,5,6-tetrahydroxycyclohexane-1,3-diyl]diguanidine} |
| Synonyms | Source |
|---|---|
| streptomycin 3''-(dihydrogen phosphate) | ChEBI |
| Streptomycin 3''-phosphate | KEGG COMPOUND |