EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O4 |
| Net Charge | 0 |
| Average Mass | 220.224 |
| Monoisotopic Mass | 220.07356 |
| SMILES | O=C(O)C(=O)CCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O4/c13-10(9-5-2-1-3-6-9)7-4-8-11(14)12(15)16/h1-3,5-6H,4,7-8H2,(H,15,16) |
| InChIKey | WHAWELFEJQCZFJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dioxo-6-phenylhexanoic acid (CHEBI:15707) has functional parent hexanoic acid (CHEBI:30776) |
| 2,6-dioxo-6-phenylhexanoic acid (CHEBI:15707) is a dioxo monocarboxylic acid (CHEBI:35951) |
| 2,6-dioxo-6-phenylhexanoic acid (CHEBI:15707) is conjugate acid of 2,6-dioxo-6-phenylhexanoate (CHEBI:57479) |
| Incoming Relation(s) |
| 2,6-dioxo-6-phenylhexanoate (CHEBI:57479) is conjugate base of 2,6-dioxo-6-phenylhexanoic acid (CHEBI:15707) |
| IUPAC Name |
|---|
| 2,6-dioxo-6-phenylhexanoic acid |
| Synonym | Source |
|---|---|
| 2,6-Dioxo-6-phenylhexanoate | KEGG COMPOUND |