EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@@]12/C=C(\C)CC[C@]3([H])C(C)(C)[C@]3([H])/C=C(\C)C(=O)[C@@]1(O)C[C@H](C)C2=O |
| InChI | InChI=1S/C20H28O3/c1-11-6-7-14-15(19(14,4)5)9-12(2)18(22)20(23)10-13(3)17(21)16(20)8-11/h8-9,13-16,23H,6-7,10H2,1-5H3/b11-8+,12-9+/t13-,14-,15+,16-,20+/m0/s1 |
| InChIKey | IJTPHJTXFYPJHI-GPBLISQPSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jolkinol C (CHEBI:156580) is a lathyrane diterpenoid (CHEBI:85247) |
| UniProt Name | Source |
|---|---|
| jolkinol C | UniProt |
| Citations |
|---|