EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO3 |
| Net Charge | 0 |
| Average Mass | 287.359 |
| Monoisotopic Mass | 287.15214 |
| SMILES | C[C@@H](NCCc1ccc(O)cc1)[C@@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H21NO3/c1-12(17(21)14-4-8-16(20)9-5-14)18-11-10-13-2-6-15(19)7-3-13/h2-9,12,17-21H,10-11H2,1H3/t12-,17-/m1/s1 |
| InChIKey | IOVGROKTTNBUGK-SJKOYZFVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R)-ritodrine (CHEBI:156577) is a 4-[2-[[1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenol (CHEBI:91775) |
| (1S,2R)-ritodrine (CHEBI:156577) is enantiomer of (1R,2S)-ritodrine (CHEBI:156576) |
| Incoming Relation(s) |
| ritodrine (CHEBI:8872) has part (1S,2R)-ritodrine (CHEBI:156577) |
| (1R,2S)-ritodrine (CHEBI:156576) is enantiomer of (1S,2R)-ritodrine (CHEBI:156577) |
| IUPAC Name |
|---|
| 4-[(1S,2R)-1-hydroxy-2-{[2-(4-hydroxyphenyl)ethyl]amino}propyl]phenol |
| Synonyms | Source |
|---|---|
| (1S,2R)-2-(4-hydroxyphenethylamino)-1-(4-hydroxyphenyl)-1-propanol | ChEBI |
| (+)-erythro-1-(p-hydroxyphenyl)-2-[2-(p-hydroxyphenyl)ethylamino]-1-propanol | ChEBI |
| (+)-ritodrine | ChEBI |
| Citations |
|---|