EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H3O2S.H4N |
| Net Charge | 0 |
| Average Mass | 109.150 |
| Monoisotopic Mass | 109.01975 |
| SMILES | O=C([O-])CS.[NH4+] |
| InChI | InChI=1S/C2H4O2S.H3N/c3-2(4)1-5;/h5H,1H2,(H,3,4);1H3 |
| InChIKey | ZZTCCAPMZLDHFM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ammonium thioglycolate (CHEBI:156555) has part thioglycolate(1−) (CHEBI:30066) |
| ammonium thioglycolate (CHEBI:156555) has role allergen (CHEBI:50904) |
| ammonium thioglycolate (CHEBI:156555) has role reducing agent (CHEBI:63247) |
| ammonium thioglycolate (CHEBI:156555) is a organic ammonium salt (CHEBI:143100) |
| IUPAC Name |
|---|
| ammonium sulfanylacetate |
| Synonyms | Source |
|---|---|
| Ammonium mercaptoacetate | ChemIDplus |
| Mercaptoacetic acid, monoammonium salt | ChemIDplus |
| Thioglycolic acid ammonium salt | ChemIDplus |
| Citations |
|---|