EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H8Cl2N2O7 |
| Net Charge | 0 |
| Average Mass | 399.142 |
| Monoisotopic Mass | 397.97086 |
| SMILES | O=C(O)c1ccc(C(=O)Nc2c(O)c3cc(Cl)c(O)c(Cl)c3oc2=O)n1 |
| InChI | InChI=1S/C15H8Cl2N2O7/c16-5-3-4-10(20)9(15(25)26-12(4)8(17)11(5)21)19-13(22)6-1-2-7(18-6)14(23)24/h1-3,18,20-21H,(H,19,22)(H,23,24) |
| InChIKey | XKCFYLTVOFQSHE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Catenulispora acidiphila DSM 44928 (ncbitaxon:479433) | - | PubMed (24554531) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cacibiocin B (CHEBI:156552) has functional parent cacibiocin A (CHEBI:156551) |
| cacibiocin B (CHEBI:156552) has part δ-lactone ring (CHEBI:52940) |
| cacibiocin B (CHEBI:156552) has role bacterial metabolite (CHEBI:76969) |
| cacibiocin B (CHEBI:156552) is a aminocoumarin (CHEBI:85128) |
| cacibiocin B (CHEBI:156552) is a diol (CHEBI:23824) |
| cacibiocin B (CHEBI:156552) is a organochlorine compound (CHEBI:36683) |
| cacibiocin B (CHEBI:156552) is a pyrrolecarboxylic acid (CHEBI:26454) |
| cacibiocin B (CHEBI:156552) is a secondary amide (CHEBI:33257) |
| cacibiocin B (CHEBI:156552) is a δ-lactone (CHEBI:18946) |
| Citations |
|---|