EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O4S |
| Net Charge | 0 |
| Average Mass | 166.198 |
| Monoisotopic Mass | 166.02998 |
| SMILES | O=C(CS)OCC(O)CO |
| InChI | InChI=1S/C5H10O4S/c6-1-4(7)2-9-5(8)3-10/h4,6-7,10H,1-3H2 |
| InChIKey | DOGJSOZYUGJVKS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyceryl monothioglycolate (CHEBI:156545) has role allergen (CHEBI:50904) |
| glyceryl monothioglycolate (CHEBI:156545) is a thioglycolate ester (CHEBI:48619) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl sulfanylacetate |
| Synonyms | Source |
|---|---|
| Glycerol monomercaptoacetate | ChemIDplus |
| Glyceryl thioglycolate | ChemIDplus |
| Mercaptoacetic acid, monoester with 1,2,3-propanetriol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:30618-84-9 | ChemIDplus |
| Citations |
|---|