EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N2.H2O4S |
| Net Charge | 0 |
| Average Mass | 220.250 |
| Monoisotopic Mass | 220.05178 |
| SMILES | Cc1cc(N)ccc1N.O=S(=O)(O)O |
| InChI | InChI=1S/C7H10N2.H2O4S/c1-5-4-6(8)2-3-7(5)9;1-5(2,3)4/h2-4H,8-9H2,1H3;(H2,1,2,3,4) |
| InChIKey | KZTWOUOZKZQDMN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-diaminotoluene sulfate (CHEBI:156544) has functional parent 2-methyl-1,4-phenylenediamine (CHEBI:53619) |
| 2,5-diaminotoluene sulfate (CHEBI:156544) has role allergen (CHEBI:50904) |
| 2,5-diaminotoluene sulfate (CHEBI:156544) is a diamine (CHEBI:23666) |
| 2,5-diaminotoluene sulfate (CHEBI:156544) is a organic sulfate salt (CHEBI:51337) |
| IUPAC Name |
|---|
| 2-methylbenzene-1,4-diamine sulfate (1:1) |
| Synonyms | Source |
|---|---|
| 2-Methyl-1,4-benzenediamine sulfate | ChemIDplus |
| 2-Methyl-p-phenylenediamine sulfate | ChemIDplus |
| Toluene-2,5-diamine, sulfate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:615-50-9 | ChemIDplus |
| Citations |
|---|