EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H27BCl2O3 |
| Net Charge | 0 |
| Average Mass | 505.250 |
| Monoisotopic Mass | 504.14303 |
| SMILES | CC1(C)OB(c2ccc(/C=C/C3=Cc4cc(Cl)cc(Cl)c4OC3c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C29H27BCl2O3/c1-28(2)29(3,4)35-30(34-28)23-14-11-19(12-15-23)10-13-21-16-22-17-24(31)18-25(32)27(22)33-26(21)20-8-6-5-7-9-20/h5-18,26H,1-4H3/b13-10+ |
| InChIKey | NLWWGBDFLKSQIM-JLHYYAGUSA-N |
| Roles Classification |
|---|
| Biological Role: | retinoic acid receptor alpha/beta agonist Any retinoic acid receptor (RAR) agonist with specificity for RARα and RARβ. |
| Application: | retinoic acid receptor alpha/beta agonist Any retinoic acid receptor (RAR) agonist with specificity for RARα and RARβ. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[4-[(E)-2-(6,8-dichloro-2-phenyl-2H-chromen-3-yl)ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CHEBI:156534) has role retinoic acid receptor α/β agonist (CHEBI:50741) |
| 2-[4-[(E)-2-(6,8-dichloro-2-phenyl-2H-chromen-3-yl)ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CHEBI:156534) is a benzenes (CHEBI:22712) |
| 2-[4-[(E)-2-(6,8-dichloro-2-phenyl-2H-chromen-3-yl)ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CHEBI:156534) is a boronate ester (CHEBI:50979) |
| 2-[4-[(E)-2-(6,8-dichloro-2-phenyl-2H-chromen-3-yl)ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CHEBI:156534) is a chromenes (CHEBI:23232) |
| 2-[4-[(E)-2-(6,8-dichloro-2-phenyl-2H-chromen-3-yl)ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CHEBI:156534) is a olefinic compound (CHEBI:78840) |
| 2-[4-[(E)-2-(6,8-dichloro-2-phenyl-2H-chromen-3-yl)ethenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CHEBI:156534) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 6,8-dichloro-2-phenyl-3-{(E)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl}-2H-chromene |
| Synonyms | Source |
|---|---|
| 6,8-dichloro-2-phenyl-3-{(E)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl}-2H-1-benzopyran | IUPAC |
| BD-4 | ChEBI |
| BD4 | SUBMITTER |
| BJ-1 | ChEBI |
| BJ1 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| US2019249259 | Patent |
| Citations |
|---|