EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24N6O3 |
| Net Charge | 0 |
| Average Mass | 312.374 |
| Monoisotopic Mass | 312.19099 |
| SMILES | CC(C)C(N)C(=O)NC(C(=O)O)C1CC(NC(=N)N)C2CN21 |
| InChI | InChI=1S/C13H24N6O3/c1-5(2)9(14)11(20)18-10(12(21)22)7-3-6(17-13(15)16)8-4-19(7)8/h5-10H,3-4,14H2,1-2H3,(H,18,20)(H,21,22)(H4,15,16,17) |
| InChIKey | DGIHWRUPUISVIZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces ficellus (ncbitaxon:1977088) | - | PubMed (28894917) | Strain: NRRL8067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ficellomycin (CHEBI:156531) has part L-valine (CHEBI:16414) |
| ficellomycin (CHEBI:156531) has part guanidino group (CHEBI:48551) |
| ficellomycin (CHEBI:156531) has role antibacterial agent (CHEBI:33282) |
| ficellomycin (CHEBI:156531) has role bacterial metabolite (CHEBI:76969) |
| ficellomycin (CHEBI:156531) has role DNA synthesis inhibitor (CHEBI:59517) |
| ficellomycin (CHEBI:156531) is a alkaloid (CHEBI:22315) |
| ficellomycin (CHEBI:156531) is a aziridines (CHEBI:22681) |
| ficellomycin (CHEBI:156531) is a dipeptide (CHEBI:46761) |
| ficellomycin (CHEBI:156531) is a pyrrolidines (CHEBI:38260) |
| Citations |
|---|