EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24N6O3 |
| Net Charge | 0 |
| Average Mass | 312.374 |
| Monoisotopic Mass | 312.19099 |
| SMILES | CC(C)C(N)C(=O)NC(C(=O)O)C1CC(NC(=N)N)C2CN21 |
| InChI | InChI=1S/C13H24N6O3/c1-5(2)9(14)11(20)18-10(12(21)22)7-3-6(17-13(15)16)8-4-19(7)8/h5-10H,3-4,14H2,1-2H3,(H,18,20)(H,21,22)(H4,15,16,17) |
| InChIKey | DGIHWRUPUISVIZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces ficellus (ncbitaxon:1977088) | - | PubMed (28894917) | Strain: NRRL8067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ficellomycin (CHEBI:156531) has part L-valine (CHEBI:16414) |
| ficellomycin (CHEBI:156531) has part guanidino group (CHEBI:48551) |
| ficellomycin (CHEBI:156531) has role antibacterial agent (CHEBI:33282) |
| ficellomycin (CHEBI:156531) has role bacterial metabolite (CHEBI:76969) |
| ficellomycin (CHEBI:156531) has role DNA synthesis inhibitor (CHEBI:59517) |
| ficellomycin (CHEBI:156531) is a alkaloid (CHEBI:22315) |
| ficellomycin (CHEBI:156531) is a aziridines (CHEBI:22681) |
| ficellomycin (CHEBI:156531) is a dipeptide (CHEBI:46761) |
| ficellomycin (CHEBI:156531) is a pyrrolidines (CHEBI:38260) |
| Citations |
|---|