EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O6 |
| Net Charge | 0 |
| Average Mass | 342.347 |
| Monoisotopic Mass | 342.11034 |
| SMILES | COc1cc(/C=C/c2cc(/C=C/C(=O)O)cc(OC)c2O)ccc1O |
| InChI | InChI=1S/C19H18O6/c1-24-16-10-12(4-7-15(16)20)3-6-14-9-13(5-8-18(21)22)11-17(25-2)19(14)23/h3-11,20,23H,1-2H3,(H,21,22)/b6-3+,8-5+ |
| InChIKey | SLIMCXCSQXYCGL-JENUQAQBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | - | PubMed (15495409) | |
| Zea mays subsp. mays (ncbitaxon:381124) | - | PubMed (25775513) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| poacic acid (CHEBI:156511) has role antifungal agent (CHEBI:35718) |
| poacic acid (CHEBI:156511) has role plant metabolite (CHEBI:76924) |
| poacic acid (CHEBI:156511) is a hydroxycinnamic acid (CHEBI:24689) |
| poacic acid (CHEBI:156511) is a methoxycinnamic acid (CHEBI:61407) |
| poacic acid (CHEBI:156511) is a monomethoxybenzene (CHEBI:25235) |
| poacic acid (CHEBI:156511) is a polyphenol (CHEBI:26195) |
| poacic acid (CHEBI:156511) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| (2E)-3-{4-hydroxy-3-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-5-methoxyphenyl}prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 3-(3-methoxy-4-hydroxystyryl)-4-hydroxy-5-methoxycinnamic acid | ChEBI |
| 8,5'-diferulic acid (decarboxylated form) | ChEBI |
| decarboxylated 8,5'-diferulic acid | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| Decarboxylated_8,5'-diferulic_acid | Wikipedia |
| Citations |
|---|