EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13NO2 |
| Net Charge | 0 |
| Average Mass | 215.252 |
| Monoisotopic Mass | 215.09463 |
| SMILES | O=C(/C=C/C=C/C=C/c1ccccc1)NO |
| InChI | InChI=1S/C13H13NO2/c15-13(14-16)11-7-2-1-4-8-12-9-5-3-6-10-12/h1-11,16H,(H,14,15)/b2-1+,8-4+,11-7+ |
| InChIKey | DBBYYRWVNDQECM-CDWOPPGASA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CG-1521 (CHEBI:156510) has role antineoplastic agent (CHEBI:35610) |
| CG-1521 (CHEBI:156510) has role apoptosis inducer (CHEBI:68495) |
| CG-1521 (CHEBI:156510) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| CG-1521 (CHEBI:156510) is a enamide (CHEBI:51751) |
| CG-1521 (CHEBI:156510) is a hydroxamic acid (CHEBI:24650) |
| CG-1521 (CHEBI:156510) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (2E,4E,6E)-N-hydroxy-7-phenylhepta-2,4,6-trienamide |
| Synonyms | Source |
|---|---|
| (2E,4E,6E)-N-hydroxy-7-phenyl-2,4,6-heptatrienamide | ChemIDplus |
| CG-1521 | ChemIDplus |
| JW-1521 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:674767-29-4 | ChemIDplus |
| Citations |
|---|