EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:156498 - rohitukine
| Formula | C16H19NO5 |
| Net Charge | 0 |
| Average Mass | 305.330 |
| Monoisotopic Mass | 305.12632 |
| SMILES | [H][C@]1(c2c(O)cc(O)c3c(=O)cc(C)oc23)CCN(C)C[C@H]1O |
| InChI | InChI=1S/C16H19NO5/c1-8-5-10(18)15-12(20)6-11(19)14(16(15)22-8)9-3-4-17(2)7-13(9)21/h5-6,9,13,19-21H,3-4,7H2,1-2H3/t9-,13+/m0/s1 |
| InChIKey | MOCVYVBNJQIVOV-TVQRCGJNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amoora rohituka (IPNI:20008225-1) | - | PubMed (19686817) | |
| Dysoxylum acutangulum (ncbitaxon:1504427) | - | PubMed (19757855) | |
| Dysoxylum binectariferum (ncbitaxon:693285) | bark (BTO:0001301) | PubMed (22113419) | Isolated from stem bark. |
| Fusarium proliferatum (ncbitaxon:948311) | - | PubMed (21898150) | Strain: MTCC 9690 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. anticholesteremic drug A substance used to lower plasma cholesterol levels. anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rohitukine (CHEBI:156498) has role anti-inflammatory agent (CHEBI:67079) |
| rohitukine (CHEBI:156498) has role anti-ulcer drug (CHEBI:49201) |
| rohitukine (CHEBI:156498) has role anticholesteremic drug (CHEBI:35821) |
| rohitukine (CHEBI:156498) has role antileishmanial agent (CHEBI:70868) |
| rohitukine (CHEBI:156498) has role antineoplastic agent (CHEBI:35610) |
| rohitukine (CHEBI:156498) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| rohitukine (CHEBI:156498) has role fungal metabolite (CHEBI:76946) |
| rohitukine (CHEBI:156498) has role plant metabolite (CHEBI:76924) |
| rohitukine (CHEBI:156498) is a alkaloid (CHEBI:22315) |
| rohitukine (CHEBI:156498) is a chromones (CHEBI:23238) |
| rohitukine (CHEBI:156498) is a hydroxypiperidine (CHEBI:48590) |
| rohitukine (CHEBI:156498) is a resorcinols (CHEBI:33572) |
| rohitukine (CHEBI:156498) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-2-methyl-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 5,7-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]-2-methyl-4H-1-benzopyran-4-one | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C00048080 | KNApSAcK |
| CN101139344 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:71294-60-5 | KNApSAcK |
| Citations |
|---|