EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | [H][C@]12CC=C(C=C)[C@H](C)[C@]1([H])C[C@@H](O)[C@]1(O)[C@]2(C)CC[C@]2([H])OC(=O)[C@]12C |
| InChI | InChI=1S/C20H28O4/c1-5-12-6-7-14-13(11(12)2)10-15(21)20(23)18(14,3)9-8-16-19(20,4)17(22)24-16/h5-6,11,13-16,21,23H,1,7-10H2,2-4H3/t11-,13-,14-,15+,16-,18+,19+,20-/m0/s1 |
| InChIKey | GPFXZYJYVUTNSE-LCPICFLISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aporospora terricola (ncbitaxon:73565) | - | PubMed (25544045) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor An EC 3.6.4.* (hydrolases acting on ATP; involved in cellular and subcellular movement) inhibitor that interferes with the action of a non-chaperonin molecular chaperone ATPase (EC 3.6.4.10). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| novolactone (CHEBI:156497) has role EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor (CHEBI:76939) |
| novolactone (CHEBI:156497) has role fungal metabolite (CHEBI:76946) |
| novolactone (CHEBI:156497) is a diterpene lactone (CHEBI:49193) |
| novolactone (CHEBI:156497) is a secondary alcohol (CHEBI:35681) |
| novolactone (CHEBI:156497) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| 13-ethenyl-5,6β-dihydroxy-14α-methyl-3β-3,15-epoxypodocarp-12-en-15-one |
| Synonym | Source |
|---|---|
| (2aS,2bS,3R,4aS,5R,8aS,8bR,10aS)-6-ethenyl-2b,3-dihydroxy-2a,5,8b-trimethyl-2a,2b,3,4,4a,5,8,8a,8b,9,10,10a-dodecahydro-2H-phenanthro[2,1-b]oxet-2-one | IUPAC |
| Citations |
|---|