EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O2 |
| Net Charge | 0 |
| Average Mass | 272.388 |
| Monoisotopic Mass | 272.17763 |
| SMILES | CCCCC/C=C/C=C/C=C/c1cccc(O)c1CO |
| InChI | InChI=1S/C18H24O2/c1-2-3-4-5-6-7-8-9-10-12-16-13-11-14-18(20)17(16)15-19/h6-14,19-20H,2-5,15H2,1H3/b7-6+,9-8+,12-10+ |
| InChIKey | UHIUUHNZAFMODU-RWAOKGLLSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| virensol B (CHEBI:156476) has role fungal metabolite (CHEBI:76946) |
| virensol B (CHEBI:156476) is a aromatic primary alcohol (CHEBI:33857) |
| virensol B (CHEBI:156476) is a hydroxybenzyl alcohol (CHEBI:24679) |
| virensol B (CHEBI:156476) is a olefinic compound (CHEBI:78840) |
| virensol B (CHEBI:156476) is a primary allylic alcohol (CHEBI:134394) |
| IUPAC Name |
|---|
| 2-(hydroxymethyl)-3-[(1E,3E,5E)-undeca-1,3,5-trien-1-yl]phenol |
| UniProt Name | Source |
|---|---|
| virensol B | UniProt |
| Citations |
|---|