EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H17BrF12N2O2 |
| Net Charge | 0 |
| Average Mass | 721.336 |
| Monoisotopic Mass | 720.02818 |
| SMILES | O=C(Nc1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1C(F)(F)F)c1cccc(N(CC2CC2)C(=O)c2ccc(F)cc2)c1F |
| InChI | InChI=1S/C28H17BrF12N2O2/c29-19-11-15(25(32,27(36,37)38)28(39,40)41)10-18(26(33,34)35)22(19)42-23(44)17-2-1-3-20(21(17)31)43(12-13-4-5-13)24(45)14-6-8-16(30)9-7-14/h1-3,6-11,13H,4-5,12H2,(H,42,44) |
| InChIKey | WULALRGFFYJWOL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyproflanilide (CHEBI:156471) has role agrochemical (CHEBI:33286) |
| cyproflanilide (CHEBI:156471) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| cyproflanilide (CHEBI:156471) is a benzamides (CHEBI:22702) |
| cyproflanilide (CHEBI:156471) is a bromobenzenes (CHEBI:37149) |
| cyproflanilide (CHEBI:156471) is a cyclopropanes (CHEBI:51454) |
| cyproflanilide (CHEBI:156471) is a monofluorobenzenes (CHEBI:83575) |
| cyproflanilide (CHEBI:156471) is a organofluorine insecticide (CHEBI:38804) |
| cyproflanilide (CHEBI:156471) is a secondary carboxamide (CHEBI:140325) |
| cyproflanilide (CHEBI:156471) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-3-[(cyclopropylmethyl)(4-fluorobenzoyl)amino]-2-fluorobenzamide |
| Synonyms | Source |
|---|---|
| 3'-[({2-bromo-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-6-(trifluoromethyl)phenyl}amino)carbonyl]-N-(cyclopropylmethyl)-2',4-difluorobenzanilide | Alan Wood's Pesticides |
| 3'-({6-bromo-α,α,α-trifluoro-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-o-tolyl}carbamoyl)-N-(cyclopropylmethyl)-2',4-difluorobenzanilide | Alan Wood's Pesticides |
| CAC-I-785 | ChEBI |
| N-(3-{[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl}-2-fluorophenyl)-N-(cyclopropylmethyl)-4-fluorobenzamide | Alan Wood's Pesticides |
| N-[3-[[[2-bromo-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-6-(trifluoromethyl)phenyl]amino]carbonyl]-2-fluorophenyl]-N-(cyclopropylmethyl)-4-fluorobenzamide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 3462 | PPDB |
| cyproflanilide | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:33574278 | Reaxys |
| CAS:2375110-88-4 | Alan Wood's Pesticides |
| CAS:2375110-88-4 | ChemIDplus |
| Citations |
|---|