EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O7 |
| Net Charge | 0 |
| Average Mass | 366.370 |
| Monoisotopic Mass | 366.14270 |
| SMILES | O=C(O)C1Cc2c(nc3ccccc23)C([C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)N1 |
| InChI | InChI=1S/C17H22N2O7/c20-6-11(21)14(22)16(24)15(23)13-12-8(5-10(19-13)17(25)26)7-3-1-2-4-9(7)18-12/h1-4,10-11,13-16,18-24H,5-6H2,(H,25,26)/t10?,11-,13?,14+,15+,16+/m1/s1 |
| InChIKey | LCHFAYIGHOVWSA-LEDUIRAGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (8206887) | |
| Eudistoma (ncbitaxon:286195) | - | PubMed (10346975) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydropentoxyline (CHEBI:156470) has role animal metabolite (CHEBI:75767) |
| tetrahydropentoxyline (CHEBI:156470) has role human urinary metabolite (CHEBI:84087) |
| tetrahydropentoxyline (CHEBI:156470) is a monocarboxylic acid (CHEBI:25384) |
| tetrahydropentoxyline (CHEBI:156470) is a pentitol derivative (CHEBI:63434) |
| tetrahydropentoxyline (CHEBI:156470) is a β-carbolines (CHEBI:60834) |
| IUPAC Name |
|---|
| (5S)-5-C-(3-carboxy-2,3,4,9-tetrahydro-1H-β-carbolin-1-yl)-D-arabinitol |
| Synonym | Source |
|---|---|
| 1-[(1S,2R,3S,4R)-1,2,3,4,5-pentahydroxypentyl]-2,3,4,9-tetrahydro-1H-β-carboline-3-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029992 | HMDB |
| FDB001280 | FooDB |
| Registry Numbers | Sources |
|---|---|
| CAS:154204-09-8 | ChemIDplus |
| Citations |
|---|