EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35O5 |
| Net Charge | -1 |
| Average Mass | 415.550 |
| Monoisotopic Mass | 415.24900 |
| SMILES | [H][C@@]12CC[C@H](C)[C@@]3(C[C@]4(C)C(C)=C(C(=O)[O-])C(=O)C(C)=C4O3)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C25H36O5/c1-13-8-9-16-22(4,5)17(26)10-11-24(16,7)25(13)12-23(6)15(3)18(21(28)29)19(27)14(2)20(23)30-25/h13,16-17,26H,8-12H2,1-7H3,(H,28,29)/p-1/t13-,16-,17-,23+,24-,25-/m0/s1 |
| InChIKey | IPYDBSMFYHWPBT-ACHAHUHRSA-M |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asnovolin H(1−) (CHEBI:156465) is a cyclic ketone (CHEBI:3992) |
| asnovolin H(1−) (CHEBI:156465) is a meroterpenoid (CHEBI:64419) |
| asnovolin H(1−) (CHEBI:156465) is a organic heterotetracyclic compound (CHEBI:38163) |
| UniProt Name | Source |
|---|---|
| asnovolin H | UniProt |
| Citations |
|---|