EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O6 |
| Net Charge | 0 |
| Average Mass | 446.584 |
| Monoisotopic Mass | 446.26684 |
| SMILES | [H][C@@]12CC[C@H](C)[C@@]3(C[C@@]4(C)C(=C(C)C(=O)[C@@H](C(=O)OC)[C@@H]4C)O3)[C@@]1(C)CCC(=O)OC2(C)C |
| InChI | InChI=1S/C26H38O6/c1-14-9-10-17-23(4,5)31-18(27)11-12-25(17,7)26(14)13-24(6)16(3)19(22(29)30-8)20(28)15(2)21(24)32-26/h14,16-17,19H,9-13H2,1-8H3/t14-,16-,17-,19-,24+,25-,26-/m0/s1 |
| InChIKey | GUSKPTPZRRTGAQ-IGZQQFENSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asnovolin A (CHEBI:156459) is a cyclic ketone (CHEBI:3992) |
| asnovolin A (CHEBI:156459) is a meroterpenoid (CHEBI:64419) |
| asnovolin A (CHEBI:156459) is a methyl ester (CHEBI:25248) |
| asnovolin A (CHEBI:156459) is a organic heterotetracyclic compound (CHEBI:38163) |
| UniProt Name | Source |
|---|---|
| asnovolin A | UniProt |
| Citations |
|---|