EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N4O4 |
| Net Charge | 0 |
| Average Mass | 422.485 |
| Monoisotopic Mass | 422.19541 |
| SMILES | C[C@@H](NC(=O)[C@H](N)Cc1ccccc1)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C23H26N4O4/c1-14(26-22(29)18(24)11-15-7-3-2-4-8-15)21(28)27-20(23(30)31)12-16-13-25-19-10-6-5-9-17(16)19/h2-10,13-14,18,20,25H,11-12,24H2,1H3,(H,26,29)(H,27,28)(H,30,31)/t14-,18-,20+/m1/s1 |
| InChIKey | NEHSHYOUIWBYSA-DJKXOVBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paenibacillus larvae (ncbitaxon:1464) | - | PubMed (25529345) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sevadicin (CHEBI:156456) has part D-alanine residue (CHEBI:29949) |
| sevadicin (CHEBI:156456) has part D-phenylalanine residue (CHEBI:29996) |
| sevadicin (CHEBI:156456) has part tryptophan residue (CHEBI:32732) |
| sevadicin (CHEBI:156456) has role antibacterial agent (CHEBI:33282) |
| sevadicin (CHEBI:156456) has role bacterial metabolite (CHEBI:76969) |
| sevadicin (CHEBI:156456) is a benzenes (CHEBI:22712) |
| sevadicin (CHEBI:156456) is a carboxylic acid (CHEBI:33575) |
| sevadicin (CHEBI:156456) is a indoles (CHEBI:24828) |
| sevadicin (CHEBI:156456) is a primary amine (CHEBI:32877) |
| sevadicin (CHEBI:156456) is a secondary amine (CHEBI:32863) |
| sevadicin (CHEBI:156456) is a tripeptide (CHEBI:47923) |
| Synonym | Source |
|---|---|
| D-Phe-D-ALa-Trp | SUBMITTER |
| Citations |
|---|