EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H7Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 272.087 |
| Monoisotopic Mass | 270.98030 |
| SMILES | O=C(c1cc(Cl)c(Cl)n1)c1c(O)cccc1O |
| InChI | InChI=1S/C11H7Cl2NO3/c12-5-4-6(14-11(5)13)10(17)9-7(15)2-1-3-8(9)16/h1-4,14-16H |
| InChIKey | JPGWTZORMBTNMF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas fluorescens PF5 (ncbitaxon:1218948) | - | PubMed (16269724 ) | |
| Pseudomonas sp. M18 (ncbitaxon:228095) | - | PubMed (15033239) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyoluteorin (CHEBI:156453) has role antibacterial agent (CHEBI:33282) |
| pyoluteorin (CHEBI:156453) has role antifungal agent (CHEBI:35718) |
| pyoluteorin (CHEBI:156453) has role apoptosis inducer (CHEBI:68495) |
| pyoluteorin (CHEBI:156453) has role bacterial metabolite (CHEBI:76969) |
| pyoluteorin (CHEBI:156453) has role marine metabolite (CHEBI:76507) |
| pyoluteorin (CHEBI:156453) is a aromatic ketone (CHEBI:76224) |
| pyoluteorin (CHEBI:156453) is a diol (CHEBI:23824) |
| pyoluteorin (CHEBI:156453) is a organochlorine compound (CHEBI:36683) |
| pyoluteorin (CHEBI:156453) is a organochlorine pesticide (CHEBI:38656) |
| pyoluteorin (CHEBI:156453) is a polyketide (CHEBI:26188) |
| pyoluteorin (CHEBI:156453) is a pyrroles (CHEBI:26455) |
| pyoluteorin (CHEBI:156453) is a resorcinols (CHEBI:33572) |
| pyoluteorin (CHEBI:156453) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| (4,5-dichloro-1H-pyrrol-2-yl)(2,6-dihydroxyphenyl)methanone |
| Synonyms | Source |
|---|---|
| 2-(4,5-dichloro-1H-pyrrole-2-carbonyl)benzene-1,3-diol | IUPAC |
| 4,5-dichloropyrrol-2-yl 2,6-dihydroxyphenylketone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-17024 | MetaCyc |
| Pyoluteorin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:234664 | Reaxys |
| CAS:25683-07-2 | ChemIDplus |
| Citations |
|---|