EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H7Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 272.087 |
| Monoisotopic Mass | 270.98030 |
| SMILES | O=C(c1cc(Cl)c(Cl)n1)c1c(O)cccc1O |
| InChI | InChI=1S/C11H7Cl2NO3/c12-5-4-6(14-11(5)13)10(17)9-7(15)2-1-3-8(9)16/h1-4,14-16H |
| InChIKey | JPGWTZORMBTNMF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas fluorescens PF5 (ncbitaxon:1218948) | - | PubMed (16269724 ) | |
| Pseudomonas sp. M18 (ncbitaxon:228095) | - | PubMed (15033239) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyoluteorin (CHEBI:156453) has role antibacterial agent (CHEBI:33282) |
| pyoluteorin (CHEBI:156453) has role antifungal agent (CHEBI:35718) |
| pyoluteorin (CHEBI:156453) has role apoptosis inducer (CHEBI:68495) |
| pyoluteorin (CHEBI:156453) has role bacterial metabolite (CHEBI:76969) |
| pyoluteorin (CHEBI:156453) has role marine metabolite (CHEBI:76507) |
| pyoluteorin (CHEBI:156453) is a aromatic ketone (CHEBI:76224) |
| pyoluteorin (CHEBI:156453) is a diol (CHEBI:23824) |
| pyoluteorin (CHEBI:156453) is a organochlorine compound (CHEBI:36683) |
| pyoluteorin (CHEBI:156453) is a organochlorine pesticide (CHEBI:38656) |
| pyoluteorin (CHEBI:156453) is a polyketide (CHEBI:26188) |
| pyoluteorin (CHEBI:156453) is a pyrroles (CHEBI:26455) |
| pyoluteorin (CHEBI:156453) is a resorcinols (CHEBI:33572) |
| pyoluteorin (CHEBI:156453) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| (4,5-dichloro-1H-pyrrol-2-yl)(2,6-dihydroxyphenyl)methanone |
| Synonyms | Source |
|---|---|
| 2-(4,5-dichloro-1H-pyrrole-2-carbonyl)benzene-1,3-diol | IUPAC |
| 4,5-dichloropyrrol-2-yl 2,6-dihydroxyphenylketone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-17024 | MetaCyc |
| Pyoluteorin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:234664 | Reaxys |
| CAS:25683-07-2 | ChemIDplus |
| Citations |
|---|