EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O |
| Net Charge | 0 |
| Average Mass | 154.213 |
| Monoisotopic Mass | 154.11061 |
| SMILES | [H][C@]12[C@@H]3CCN1C[C@@H](O3)[C@@H]2NC |
| InChI | InChI=1S/C8H14N2O/c1-9-7-6-4-10-3-2-5(11-6)8(7)10/h5-9H,2-4H2,1H3/t5-,6+,7-,8+/m0/s1 |
| InChIKey | OPMNROCQHKJDAQ-FKSUSPILSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epichloe uncinata (ncbitaxon:5050) | - | PubMed (15654104) | Cluster GenBank: AY723749.1 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. mycotoxin Poisonous substance produced by fungi. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loline (CHEBI:156448) is a loline alkaloid (CHEBI:156445) |
| loline (CHEBI:156448) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (1S,6R,7R,7aS)-N-methylhexahydro-1H-1,6-epoxypyrrolizin-7-amine |
| Synonyms | Source |
|---|---|
| (1R,3S,7S,8R)-N-methyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine | IUPAC |
| festucine | ChemIDplus |
| lolina | SUBMITTER |
| (+)-loline | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:25161-91-5 | ChemIDplus |
| Citations |
|---|