EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O |
| Net Charge | 0 |
| Average Mass | 140.186 |
| Monoisotopic Mass | 140.09496 |
| SMILES | [H][C@]12[C@@H]3CCN1C[C@@H](O3)[C@@H]2N |
| InChI | InChI=1S/C7H12N2O/c8-6-5-3-9-2-1-4(10-5)7(6)9/h4-7H,1-3,8H2/t4-,5+,6-,7+/m0/s1 |
| InChIKey | SOFXQTNEGHNRMN-BNHYGAARSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Equus caballus (ncbitaxon:9796) | urine (BTO:0001419) | PubMed (1893500) | |
| Lolium cuneatum (IPNI:407438-1) | - | DOI (10.1021/np50064a023) | |
| Lolium temulentum (ncbitaxon:34176) | - | Article (Hofmeister, F. The active constituents of lolium temulentum. Arch. Exp. Pathol. Pharmakol. 30, 203–230 (1892).) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. mycotoxin Poisonous substance produced by fungi. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antifeedant A substance that prevents pests from feeding. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norloline (CHEBI:156447) is a loline alkaloid (CHEBI:156445) |
| norloline (CHEBI:156447) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| (1S,6R,7R,7aS)-hexahydro-1H-1,6-epoxypyrrolizin-7-amine |
| Synonyms | Source |
|---|---|
| N-depropionyldecorticasine | ChemIDplus |
| temuline | SUBMITTER |
| Citations |
|---|