EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N7O |
| Net Charge | 0 |
| Average Mass | 375.436 |
| Monoisotopic Mass | 375.18076 |
| SMILES | CCC(=O)Nc1cc(Nc2cc(NC3CC3)n3ncc(C#N)c3n2)ccc1C |
| InChI | InChI=1S/C20H21N7O/c1-3-19(28)25-16-8-15(5-4-12(16)2)23-17-9-18(24-14-6-7-14)27-20(26-17)13(10-21)11-22-27/h4-5,8-9,11,14,24H,3,6-7H2,1-2H3,(H,23,26)(H,25,28) |
| InChIKey | YKDZIFFKQUNVHH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SGC-CK2-1 (CHEBI:156441) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| SGC-CK2-1 (CHEBI:156441) is a cyclopropanes (CHEBI:51454) |
| SGC-CK2-1 (CHEBI:156441) is a nitrile (CHEBI:18379) |
| SGC-CK2-1 (CHEBI:156441) is a pyrazolopyrimidine (CHEBI:38669) |
| SGC-CK2-1 (CHEBI:156441) is a secondary amino compound (CHEBI:50995) |
| SGC-CK2-1 (CHEBI:156441) is a secondary carboxamide (CHEBI:140325) |
| SGC-CK2-1 (CHEBI:156441) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| N-(5-{[3-cyano-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-5-yl]amino}-2-methylphenyl)propanamide |
| Manual Xrefs | Databases |
|---|---|
| QBE | PDBeChem |