EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32N7O15P2 |
| Net Charge | +1 |
| Average Mass | 684.469 |
| Monoisotopic Mass | 684.14261 |
| SMILES | [H][N+]1([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C=C(C(N)=O)CC[C@@H]1O |
| InChI | InChI=1S/C21H31N7O15P2/c22-17-12-19(25-6-24-17)28(7-26-12)21-16(33)14(31)10(42-21)5-40-45(37,38)43-44(35,36)39-4-9-13(30)15(32)20(41-9)27-3-8(18(23)34)1-2-11(27)29/h3,6-7,9-11,13-16,20-21,29-33H,1-2,4-5H2,(H2,23,34)(H,35,36)(H,37,38)(H2,22,24,25)/p+1/t9-,10-,11+,13-,14-,15-,16-,20-,21-/m1/s1 |
| InChIKey | IDBZKGQRLBFUFQ-VPHRTNKSSA-O |
| Roles Classification |
|---|
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-NADHX(1+) (CHEBI:15644) is a tetrahydronicotinamide adenine dinucleotide (CHEBI:26916) |
| (S)-NADHX(1+) (CHEBI:15644) is conjugate acid of (S)-NADHX (CHEBI:44236) |
| Incoming Relation(s) |
| (S)-NADHX (CHEBI:44236) is conjugate base of (S)-NADHX(1+) (CHEBI:15644) |
| IUPAC Name |
|---|
| adenosine 5'-(3-{5-[(2S)-5-carbamoyl-2-hydroxy-3,4-dihydropyridinium-1(2H)-yl]-5-deoxy-β-D-ribofuranosyl} dihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| (6S)-6-beta-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide | ChEBI |
| (6S)-6-beta-Hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide | KEGG COMPOUND |