EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO4 |
| Net Charge | 0 |
| Average Mass | 237.255 |
| Monoisotopic Mass | 237.10011 |
| SMILES | Cc1cc2c(c(=O)n1)OC(C(=O)CC(C)C)O2 |
| InChI | InChI=1S/C12H15NO4/c1-6(2)4-8(14)12-16-9-5-7(3)13-11(15)10(9)17-12/h5-6,12H,4H2,1-3H3,(H,13,15) |
| InChIKey | VALUPXXLHSBISM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavipes (ncbitaxon:41900) | - | DOI (10.1139/v77-085) | |
| Aspergillus terreus NIH2624 (ncbitaxon:341663) | - | PubMed (21236704) | |
| Calcarisporium arbuscula (ncbitaxon:240499) | - | PubMed (32580753) | Strain: NRRL 3705 |
| Phoma sp. (ncbitaxon:1707701) | - | PubMed (27376480) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . mycotoxin Poisonous substance produced by fungi. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoflavipucine (CHEBI:156435) has part isobutyl group (CHEBI:30356) |
| isoflavipucine (CHEBI:156435) has part δ-lactam ring (CHEBI:52910) |
| isoflavipucine (CHEBI:156435) has role Aspergillus metabolite (CHEBI:76956) |
| isoflavipucine (CHEBI:156435) has role antineoplastic agent (CHEBI:35610) |
| isoflavipucine (CHEBI:156435) has role mycotoxin (CHEBI:25442) |
| isoflavipucine (CHEBI:156435) is a cyclic acetal (CHEBI:59770) |
| isoflavipucine (CHEBI:156435) is a dioxolane (CHEBI:39430) |
| isoflavipucine (CHEBI:156435) is a ketone (CHEBI:17087) |
| isoflavipucine (CHEBI:156435) is a δ-lactam (CHEBI:77727) |
| IUPAC Name |
|---|
| (2R)-6-methyl-2-(3-methylbutanoyl)-5H-[1,3]dioxolo[4,5-c]pyridin-4-one |
| Synonym | Source |
|---|---|
| (±)-isoflavipucine | SUBMITTER |
| Citations |
|---|