EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H44N6NiS2 |
| Net Charge | 0 |
| Average Mass | 515.463 |
| Monoisotopic Mass | 514.24223 |
| SMILES | CC(C)=CCCC[C@H](C)/C=[N+]1/NC(N)=[SH][Ni-2]12[SH]=C(N)N/[N+]2=C/[C@@H](C)CCCC=C(C)C |
| InChI | InChI=1S/2C11H21N3S.Ni/c2*1-9(2)6-4-5-7-10(3)8-13-14-11(12)15;/h2*6,8,10H,4-5,7H2,1-3H3,(H3,12,14,15);/b2*13-8+;/t2*10-;/m00./s1 |
| InChIKey | XMGOHRCUEWOPPR-BODQBXHRSA-N |
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis(S-citronellalthiosemicarbazonato)nickel(II) (CHEBI:156433) has functional parent (S)-citronellalthiosemicarbazonate (CHEBI:156466) |
| bis(S-citronellalthiosemicarbazonato)nickel(II) (CHEBI:156433) has role antineoplastic agent (CHEBI:35610) |
| bis(S-citronellalthiosemicarbazonato)nickel(II) (CHEBI:156433) has role apoptosis inducer (CHEBI:68495) |
| bis(S-citronellalthiosemicarbazonato)nickel(II) (CHEBI:156433) is a nickel coordination entity (CHEBI:35438) |
| IUPAC Name |
|---|
| bis[2-(2,7-dimethyloct-6-en-1-ylidene)hydrazine-1-carbothioamide-κ2N2,S]nickel |
| Synonyms | Source |
|---|---|
| Ni(S-tcitr)2 | SUBMITTER |
| Ni(tcitr)2 | SUBMITTER |
| Citations |
|---|