EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O4 |
| Net Charge | 0 |
| Average Mass | 188.183 |
| Monoisotopic Mass | 188.07971 |
| SMILES | N[C@@H](CC[C@]1(O)CNC1=O)C(=O)O |
| InChI | InChI=1S/C7H12N2O4/c8-4(5(10)11)1-2-7(13)3-9-6(7)12/h4,13H,1-3,8H2,(H,9,12)(H,10,11)/t4-,7-/m0/s1 |
| InChIKey | BSUXZTMOMIFYBF-FFWSUHOLSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas syringae (ncbitaxon:317) | - | PubMed (29039929) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 6.3.1.2 (glutamate--ammonia ligase) inhibitor An EC 6.3.* (C‒N bond-forming ligase) inhibitor that interferes with the action of glutamate—ammonia ligase (EC 6.3.1.2). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tabtoxinine β-lactam (CHEBI:156430) has role apoptosis inducer (CHEBI:68495) |
| tabtoxinine β-lactam (CHEBI:156430) has role bacterial metabolite (CHEBI:76969) |
| tabtoxinine β-lactam (CHEBI:156430) has role EC 6.3.1.2 (glutamate—ammonia ligase) inhibitor (CHEBI:24319) |
| tabtoxinine β-lactam (CHEBI:156430) is a monobactam (CHEBI:50695) |
| tabtoxinine β-lactam (CHEBI:156430) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| tabtoxinine β-lactam (CHEBI:156430) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| tabtoxinine β-lactam (CHEBI:156430) is a β-lactam antibiotic (CHEBI:27933) |
| Incoming Relation(s) |
| tabtoxin (CHEBI:156429) has functional parent tabtoxinine β-lactam (CHEBI:156430) |
| IUPAC Name |
|---|
| (S)-2-amino-4-((S)-3-hydroxy-2-oxoazetidin-3-yl)butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| Tabtoxinine_%CE%B2-lactam | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:65709-93-5 | SUBMITTER |
| Citations |
|---|