EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H36N8O6S2 |
| Net Charge | 0 |
| Average Mass | 740.868 |
| Monoisotopic Mass | 740.21992 |
| SMILES | CCC(C)C1NC(=O)c2nc(oc2-c2ccccc2)-c2csc(n2)-c2csc(n2)-c2nc(oc2C)-c2coc(n2)CNC(=O)C(C(C)CC)NC1=O |
| InChI | InChI=1S/C36H36N8O6S2/c1-6-17(3)25-30(45)37-13-24-38-21(14-48-24)33-43-27(19(5)49-33)36-40-23(16-52-36)35-39-22(15-51-35)34-44-28(29(50-34)20-11-9-8-10-12-20)32(47)42-26(18(4)7-2)31(46)41-25/h8-12,14-18,25-26H,6-7,13H2,1-5H3,(H,37,45)(H,41,46)(H,42,47) |
| InChIKey | GARMIUZCKGLXIH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces aurantiacus (ncbitaxon:47760) | - | PubMed (30310179) | Genbank: WP_016640788.1 |
| Streptomyces curacoi (ncbitaxon:146536) | - | PubMed (30310179) | Genbank: WP_107116988.1 Strain: NBRC 12761 |
| Streptomyces viridochromogenes (ncbitaxon:1938) | - | PubMed (30310179) | Genbank: WP_003997107.1 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| curacozole (CHEBI:156428) has role antineoplastic agent (CHEBI:35610) |
| curacozole (CHEBI:156428) has role bacterial metabolite (CHEBI:76969) |
| curacozole (CHEBI:156428) is a 1,3-oxazoles (CHEBI:46812) |
| curacozole (CHEBI:156428) is a 1,3-thiazoles (CHEBI:38418) |
| curacozole (CHEBI:156428) is a azamacrocycle (CHEBI:52898) |
| curacozole (CHEBI:156428) is a benzenes (CHEBI:22712) |
| curacozole (CHEBI:156428) is a heterodetic cyclic peptide (CHEBI:24533) |
| IUPAC Name |
|---|
| 20,23-di(butan-2-yl)-4-methyl-16-phenyl-3,15,28-trioxa-7,11-dithia-19,22,25,30,31,32,33,34-octaazahexacyclo[25.2.1.12,5.16,9.110,13.114,17]tetratriaconta-1(29),2(34),4,6(33),8,10(32),12,14(31),16,27(30)-decaene-18,21,24-trione |
| Citations |
|---|