EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H57N9O8 |
| Net Charge | 0 |
| Average Mass | 755.918 |
| Monoisotopic Mass | 755.43301 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](C(C)C)NC(=O)[C@H](Cc2cnc3ccccc23)NC(=O)C(C(O)C(N)=O)NC(=O)[C@H](CCCN)NC1=O |
| InChI | InChI=1S/C37H57N9O8/c1-7-20(6)28-36(53)41-24(13-10-14-38)32(49)46-29(30(47)31(39)48)37(54)43-26(16-21-17-40-23-12-9-8-11-22(21)23)34(51)44-27(19(4)5)35(52)42-25(15-18(2)3)33(50)45-28/h8-9,11-12,17-20,24-30,40,47H,7,10,13-16,38H2,1-6H3,(H2,39,48)(H,41,53)(H,42,52)(H,43,54)(H,44,51)(H,45,50)(H,46,49)/t20-,24-,25+,26-,27+,28-,29?,30?/m0/s1 |
| InChIKey | OMJIEOKXBASSMV-IFENFBHBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces curacoi (ncbitaxon:146536) | - | DOI (10.1002/ajoc.201700433) | Strain: NBRC 12761 |
| Streptomyces noursei (ncbitaxon:1971) | - | DOI (10.1002/ajoc.201700433) | Strain: NBRC 15452 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dechlorocuracomycin (CHEBI:156427) has part D-leucine residue (CHEBI:30005) |
| dechlorocuracomycin (CHEBI:156427) has part D-valine residue (CHEBI:50328) |
| dechlorocuracomycin (CHEBI:156427) has part L-isoleucine residue (CHEBI:30009) |
| dechlorocuracomycin (CHEBI:156427) has part L-ornithine residue (CHEBI:44571) |
| dechlorocuracomycin (CHEBI:156427) has part L-tryptophan residue (CHEBI:29954) |
| dechlorocuracomycin (CHEBI:156427) has part 3-hydroxy-L-asparagine residue (CHEBI:141828) |
| dechlorocuracomycin (CHEBI:156427) has role bacterial metabolite (CHEBI:76969) |
| dechlorocuracomycin (CHEBI:156427) is a azamacrocycle (CHEBI:52898) |
| dechlorocuracomycin (CHEBI:156427) is a homodetic cyclic peptide (CHEBI:24613) |
| dechlorocuracomycin (CHEBI:156427) is a indoles (CHEBI:24828) |
| dechlorocuracomycin (CHEBI:156427) is a primary amide (CHEBI:33256) |