EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H56ClN9O8 |
| Net Charge | 0 |
| Average Mass | 790.363 |
| Monoisotopic Mass | 789.39404 |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](C(C)C)NC(=O)[C@H](Cc2cnc3ccc(Cl)cc23)NC(=O)C(C(O)C(N)=O)NC(=O)[C@H](CCCN)NC1=O |
| InChI | InChI=1S/C37H56ClN9O8/c1-7-19(6)28-36(54)42-24(9-8-12-39)32(50)47-29(30(48)31(40)49)37(55)44-26(14-20-16-41-23-11-10-21(38)15-22(20)23)34(52)45-27(18(4)5)35(53)43-25(13-17(2)3)33(51)46-28/h10-11,15-19,24-30,41,48H,7-9,12-14,39H2,1-6H3,(H2,40,49)(H,42,54)(H,43,53)(H,44,55)(H,45,52)(H,46,51)(H,47,50)/t19-,24-,25+,26-,27+,28-,29?,30?/m0/s1 |
| InChIKey | CUXAULQHGRSWLF-IKVCUCANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces noursei (ncbitaxon:1971) | - | DOI (10.1002/ajoc.201700433) | Strain: NBRC 15452 |
| Streptomyces curacoi (ncbitaxon:146536) | - | DOI (10.1002/ajoc.201700433) | Strain: NBRC 12761 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| curacomycin (CHEBI:156426) has role antibacterial agent (CHEBI:33282) |
| curacomycin (CHEBI:156426) has role bacterial metabolite (CHEBI:76969) |
| curacomycin (CHEBI:156426) is a chloroindole (CHEBI:52508) |
| curacomycin (CHEBI:156426) is a homodetic cyclic peptide (CHEBI:24613) |
| IUPAC Name |
|---|
| cyclo(3-hydroxyasparaginyl-5-chloro-L-tryptophyl-D-valyl-D-leucyl-L-isoleucyl-L-ornithyl) |
| Citations |
|---|