EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:156421 - celesticetin
| Formula | C24H36N2O9S |
| Net Charge | 0 |
| Average Mass | 528.624 |
| Monoisotopic Mass | 528.21415 |
| SMILES | COC(C)C(NC(=O)[C@@H]1CCCN1C)[C@H]1O[C@H](SCCOC(=O)c2ccccc2O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H36N2O9S/c1-13(33-3)17(25-22(31)15-8-6-10-26(15)2)21-19(29)18(28)20(30)24(35-21)36-12-11-34-23(32)14-7-4-5-9-16(14)27/h4-5,7,9,13,15,17-21,24,27-30H,6,8,10-12H2,1-3H3,(H,25,31)/t13?,15-,17?,18-,19+,20+,21+,24+/m0/s1 |
| InChIKey | VMSQKUCYEMOKMM-AFJAYNRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. US24 (ncbitaxon:391357) | - | PubMed (12837510) | |
| Streptomyces caelestis (ncbitaxon:36816) | - | PubMed (18298041) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| celesticetin (CHEBI:156421) has role antimicrobial agent (CHEBI:33281) |
| celesticetin (CHEBI:156421) has role bacterial metabolite (CHEBI:76969) |
| celesticetin (CHEBI:156421) is a S-glycosyl compound (CHEBI:35275) |
| celesticetin (CHEBI:156421) is a L-proline derivative (CHEBI:84186) |
| celesticetin (CHEBI:156421) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| celesticetin (CHEBI:156421) is a carboxylic ester (CHEBI:33308) |
| celesticetin (CHEBI:156421) is a monocarboxylic acid amide (CHEBI:29347) |
| celesticetin (CHEBI:156421) is a organic sulfide (CHEBI:16385) |
| celesticetin (CHEBI:156421) is a phenols (CHEBI:33853) |
| celesticetin (CHEBI:156421) is a pyrrolidinecarboxamide (CHEBI:46770) |
| celesticetin (CHEBI:156421) is a tertiary amine (CHEBI:32876) |
| celesticetin (CHEBI:156421) is a tetrol (CHEBI:33573) |
| Synonym | Source |
|---|---|
| celesticetin A | SUBMITTER |
| Citations |
|---|