EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N2O8 |
| Net Charge | 0 |
| Average Mass | 470.478 |
| Monoisotopic Mass | 470.16892 |
| SMILES | O=C(O)CCCNC(=O)C1c2cc(O)cc(O)c2C(O)(Cc2ccccc2)C2(O)CCC(=O)N12 |
| InChI | InChI=1S/C24H26N2O8/c27-15-11-16-20(17(28)12-15)23(33,13-14-5-2-1-3-6-14)24(34)9-8-18(29)26(24)21(16)22(32)25-10-4-7-19(30)31/h1-3,5-6,11-12,21,27-28,33-34H,4,7-10,13H2,(H,25,32)(H,30,31) |
| InChIKey | ZNSLKIGPUIPFNC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (31310031) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perquinoline C (CHEBI:156393) has functional parent butyric acid (CHEBI:30772) |
| perquinoline C (CHEBI:156393) is a carboxylic acid (CHEBI:33575) |
| perquinoline C (CHEBI:156393) is a tetrol (CHEBI:33573) |
| Citations |
|---|