EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25N3O7 |
| Net Charge | 0 |
| Average Mass | 455.467 |
| Monoisotopic Mass | 455.16925 |
| SMILES | NC1(Cc2ccccc2)c2c(O)cc(O)cc2C(C(=O)NCCC(=O)O)N2C(=O)CCC21O |
| InChI | InChI=1S/C23H25N3O7/c24-22(12-13-4-2-1-3-5-13)19-15(10-14(27)11-16(19)28)20(21(32)25-9-7-18(30)31)26-17(29)6-8-23(22,26)33/h1-5,10-11,20,27-28,33H,6-9,12,24H2,(H,25,32)(H,30,31) |
| InChIKey | XHJZZGRZEGUFCM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (31310031) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perquinoline B (CHEBI:156392) has functional parent propionic acid (CHEBI:30768) |
| perquinoline B (CHEBI:156392) is a carboxylic acid (CHEBI:33575) |
| perquinoline B (CHEBI:156392) is a primary amine (CHEBI:32877) |
| perquinoline B (CHEBI:156392) is a triol (CHEBI:27136) |
| Citations |
|---|