EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27N3O7 |
| Net Charge | 0 |
| Average Mass | 469.494 |
| Monoisotopic Mass | 469.18490 |
| SMILES | NC1(Cc2ccccc2)c2c(O)cc(O)cc2C(C(=O)NCCCC(=O)O)N2C(=O)CCC21O |
| InChI | InChI=1S/C24H27N3O7/c25-23(13-14-5-2-1-3-6-14)20-16(11-15(28)12-17(20)29)21(22(33)26-10-4-7-19(31)32)27-18(30)8-9-24(23,27)34/h1-3,5-6,11-12,21,28-29,34H,4,7-10,13,25H2,(H,26,33)(H,31,32) |
| InChIKey | CDFQOHHGTNUFPU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (31310031) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perquinoline A (CHEBI:156391) has functional parent butyric acid (CHEBI:30772) |
| perquinoline A (CHEBI:156391) is a carboxylic acid (CHEBI:33575) |
| perquinoline A (CHEBI:156391) is a primary amine (CHEBI:32877) |
| perquinoline A (CHEBI:156391) is a triol (CHEBI:27136) |
| Citations |
|---|